Ethyl 5-oxo-5-(3,4,5-trifluorophenyl)valerate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F207752 |
---|---|
Product Name | Ethyl 5-oxo-5-(3,4,5-trifluorophenyl)valerate |
CAS | 898752-52-8 |
Purity | 97.0% |
Molecular weight | 274.239 |
IUPAC Name | ethyl 5-oxo-5-(3,4,5-trifluorophenyl)pentanoate |
SMILES | CCOC(=O)CCCC(=O)C1=CC(F)=C(F)C(F)=C1 |
INCHI Code | InChI=1S/C13H13F3O3/c1-2-19-12(18)5-3-4-11(17)8-6-9(14)13(16)10(15)7-8/h6-7H,2-5H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.7311325 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.3846154 |
Concept Codes | Phenyl, Ketone, Ester, Fluoro, Halo, 1,2,3-Trifluorobenzene, Trifluorobenzene, Cyclic, Aromatic |