2,5-dimethyl-3'-(1,3-dioxolan-2-yl)benzophenone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F206815 |
---|---|
Product Name | 2,5-dimethyl-3'-(1,3-dioxolan-2-yl)benzophenone |
Other Names | (3-(1,3-Dioxolan-2-yl)phenyl)(2,5-dimethylphenyl)methanone |
CAS | 898779-36-7 |
Purity | 97.0% |
Molecular weight | 282.339 |
IUPAC Name | 2-[3-(2,5-dimethylbenzoyl)phenyl]-1,3-dioxolane |
SMILES | CC1=CC=C(C)C(=C1)C(=O)C1=CC=CC(=C1)C1OCCO1 |
INCHI Code | InChI=1S/C18H18O3/c1-12-6-7-13(2)16(10-12)17(19)14-4-3-5-15(11-14)18-20-8-9-21-18/h3-7,10-11,18H,8-9H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 4.442596 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.2777778 |
Concept Codes | Phenyl, Ketone, Ether, Acetal, Heterocycle, Methyl, Tolyl, Dimethyl, 5-Membered heterocycle, Cyclic, Aromatic, Benzophenone, 1,3-Dioxolane, Dioxolane, PEG-2 |