4-(3-Methoxybenzoyl)-2-methylpyridine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F203459 |
---|---|
Product Name | 4-(3-Methoxybenzoyl)-2-methylpyridine |
Other Names | (3-Methoxyphenyl)(2-methylpyridin-4-yl)methanone |
CAS | 1187169-47-6 |
Purity | 97.0% |
Molecular weight | 227.263 |
IUPAC Name | 4-(3-methoxybenzoyl)-2-methylpyridine |
SMILES | COC1=CC(=CC=C1)C(=O)C1=CC=NC(C)=C1 |
INCHI Code | InChI=1S/C14H13NO2/c1-10-8-12(6-7-15-10)14(16)11-4-3-5-13(9-11)17-2/h3-9H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.1886253 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Ketone, Methoxy, Ether, Heterocycle, Heteroaromatic, Methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic, Anisole |