2,4-dimethyl-3'-methoxybenzophenone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F201559 |
---|---|
Product Name | 2,4-dimethyl-3'-methoxybenzophenone |
Other Names | (2,4-Dimethylphenyl)(3-methoxyphenyl)methanone |
CAS | 750633-70-6 |
Purity | 97.0% |
Molecular weight | 240.302 |
IUPAC Name | (2,4-dimethylphenyl)(3-methoxyphenyl)methanone |
SMILES | COC1=CC=CC(=C1)C(=O)C1=C(C)C=C(C)C=C1 |
INCHI Code | InChI=1S/C16H16O2/c1-11-7-8-15(12(2)9-11)16(17)13-5-4-6-14(10-13)18-3/h4-10H,1-3H3 |
Asymmetric atoms | 0 |
LogP | 4.30177 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.1875 |
Concept Codes | Phenyl, Ketone, Methoxy, Ether, Methyl, Tolyl, Dimethyl, Cyclic, Aromatic, Anisole, Benzophenone |