2-chloro-3-(2-cyanophenyl)-1-propene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F200158 |
---|---|
Product Name | 2-chloro-3-(2-cyanophenyl)-1-propene |
CAS | 731772-23-9 |
Purity | 97.0% |
Molecular weight | 177.63 |
IUPAC Name | 2-(2-chloroprop-2-en-1-yl)benzonitrile |
SMILES | ClC(=C)CC1=C(C=CC=C1)C#N |
INCHI Code | InChI=1S/C10H8ClN/c1-8(11)6-9-4-2-3-5-10(9)7-12/h2-5H,1,6H2 |
Asymmetric atoms | 0 |
LogP | 3.0087683 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.1 |
Concept Codes | Phenyl, Nitrile, Chloro, Halo, Alkene, Cyclic, Aromatic, Benzonitrile |