2-(4-Ethylphenyl)-4-phenylthiazole
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F097993 |
---|---|
Product Name | 2-(4-Ethylphenyl)-4-phenylthiazole |
CAS | 1710530-81-6 |
Molecular weight | 265.37 |
IUPAC Name | 2-(4-ethylphenyl)-4-phenyl-1,3-thiazole |
SMILES | CCC1=CC=C(C=C1)C1=NC(=CS1)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C17H15NS/c1-2-13-8-10-15(11-9-13)17-18-16(12-19-17)14-6-4-3-5-7-14/h3-12H,2H2,1H3 |
Asymmetric atoms | 0 |
LogP | 5.6478744 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.11764706 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Sulfide, Ethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiazole, Cyclic, Aromatic |