3-Isopropoxy-5-(trifluoromethyl)aniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F096563 |
---|---|
Product Name | 3-Isopropoxy-5-(trifluoromethyl)aniline |
Other Names | 3-Isopropoxy-5-(trifluoromethyl)benzenamine |
CAS | 1280201-29-7 |
Purity | 95% |
Molecular weight | 219.207 |
IUPAC Name | 3-(propan-2-yloxy)-5-(trifluoromethyl)aniline |
SMILES | CC(C)OC1=CC(N)=CC(=C1)C(F)(F)F |
INCHI Code | InChI=1S/C10H12F3NO/c1-6(2)15-9-4-7(10(11,12)13)3-8(14)5-9/h3-6H,14H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.63788 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Ether, Primary amine, Amine (P+S+T), Fluoro, Halo, Trifluoromethyl, Aniline, Cyclic, Aromatic, PFA01, PFA02 |