2-(Chloromethyl)-4-(3-methoxypropoxy)-3-methylpyridine hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F093273 |
---|---|
Product Name | 2-(Chloromethyl)-4-(3-methoxypropoxy)-3-methylpyridine hydrochloride |
CAS | 153259-31-5 |
Purity | 95.0% |
Molecular weight | 266.16 |
IUPAC Name | 2-(chloromethyl)-4-(3-methoxypropoxy)-3-methylpyridine hydrochloride |
SMILES | Cl.COCCCOC1=CC=NC(CCl)=C1C |
INCHI Code | InChI=1S/C11H16ClNO2.ClH/c1-9-10(8-12)13-5-4-11(9)15-7-3-6-14-2;/h4-5H,3,6-8H2,1-2H3;1H |
Asymmetric atoms | 0 |
LogP | 1.7930217 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.54545456 |
Concept Codes | Methoxy, Ether, Heterocycle, Heteroaromatic, Chloro, Halo, Methyl, Hydrochloride, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |