6-Chloro-5-(2-chloroethyl)indolin-2-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F092030 |
---|---|
Product Name | 6-Chloro-5-(2-chloroethyl)indolin-2-one |
Other Names | 5-CHLOROETHYL-6-CHLORO-1,3-DIHYDRO-2H-INDOLE-2-ONE 6-chloro-5-(2-chloroethyl)-1,3-dihydro-2H-indol-2-one 6-Chloro-5-(2-chloroethyl)oxindole |
CAS | 118289-55-7 |
Purity | 95.0% |
Molecular weight | 230.09 |
IUPAC Name | 6-chloro-5-(2-chloroethyl)-2,3-dihydro-1H-indol-2-one |
SMILES | ClCCC1=CC2=C(NC(=O)C2)C=C1Cl |
INCHI Code | InChI=1S/C10H9Cl2NO/c11-2-1-6-3-7-4-10(14)13-9(7)5-8(6)12/h3,5H,1-2,4H2,(H,13,14) |
Asymmetric atoms | 0 |
LogP | 2.5519981 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.3 |
Concept Codes | Heterocycle, Amide, Chloro, Halo, Lactam, 5-Membered heterocycle, Cyclic, Aromatic, Indoline, Oxindole |