3-Cyclopropylaminomethyl-benzonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F088734 |
---|---|
Product Name | 3-Cyclopropylaminomethyl-benzonitrile |
Other Names | 3-((Cyclopropylamino)methyl)benzonitrile |
CAS | 954580-85-9 |
Molecular weight | 172.231 |
IUPAC Name | 3-[(cyclopropylamino)methyl]benzonitrile |
SMILES | N#CC1=CC(CNC2CC2)=CC=C1 |
INCHI Code | InChI=1S/C11H12N2/c12-7-9-2-1-3-10(6-9)8-13-11-4-5-11/h1-3,6,11,13H,4-5,8H2 |
Asymmetric atoms | 0 |
LogP | 1.8532554 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.36363637 |
Concept Codes | Phenyl, Secondary amine, Amine (P+S+T), Nitrile, Cyclic, Aromatic, Benzonitrile, Cyclopropane |