1-[3-(Benzyl-ethyl-amino)-pyrrolidin-1-yl]-2-chloro-ethanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F084204 |
---|---|
Product Name | 1-[3-(Benzyl-ethyl-amino)-pyrrolidin-1-yl]-2-chloro-ethanone |
Other Names | 1-(3-(Benzyl(ethyl)amino)pyrrolidin-1-yl)-2-chloroethanone |
CAS | 1353955-13-1 |
Molecular weight | 280.8 |
IUPAC Name | 1-{3-[benzyl(ethyl)amino]pyrrolidin-1-yl}-2-chloroethan-1-one |
SMILES | CCN(CC1=CC=CC=C1)C1CCN(C1)C(=O)CCl |
INCHI Code | InChI=1/C15H21ClN2O/c1-2-17(11-13-6-4-3-5-7-13)14-8-9-18(12-14)15(19)10-16/h3-7,14H,2,8-12H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.002535 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.53333336 |
Concept Codes | Phenyl, Heterocycle, Amide, Tertiary amine, Amine (P+S+T), Chloro, Halo, NBenzyl, 5-Membered heterocycle, Pyrrolidine, Cyclic, Aromatic |