3-((S)-2-Amino-propionylamino)-piperidine-1-carboxylic acid benzyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F081616 |
---|---|
Product Name | 3-((S)-2-Amino-propionylamino)-piperidine-1-carboxylic acid benzyl ester |
CAS | 1354033-06-9 |
Molecular weight | 305.378 |
IUPAC Name | benzyl 3-[(2S)-2-aminopropanamido]piperidine-1-carboxylate |
SMILES | C[C@H](N)C(=O)NC1CCCN(C1)C(=O)OCC1=CC=CC=C1 |
INCHI Code | InChI=1/C16H23N3O3/c1-12(17)15(20)18-14-8-5-9-19(10-14)16(21)22-11-13-6-3-2-4-7-13/h2-4,6-7,12,14H,5,8-11,17H2,1H3,(H,18,20)/t12-,14?/s2 |
Asymmetric atoms | 2 |
LogP | 0.8928898 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.5 |
Concept Codes | Phenyl, Heterocycle, Amide, Primary amine, Amine (P+S+T), Chiral, NCbz, 6-Membered heterocycle, Chiral amide, Chiral amine, Piperidine, Cyclic, Aromatic, O-Benzyl |