(S)-2-{[Ethyl-(2-hydroxy-ethyl)-amino]-methyl}-pyrrolidine-1-carboxylic acid benzyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F080996 |
---|---|
Product Name | (S)-2-{[Ethyl-(2-hydroxy-ethyl)-amino]-methyl}-pyrrolidine-1-carboxylic acid benzyl ester |
CAS | 1353994-10-1 |
Molecular weight | 306.406 |
IUPAC Name | benzyl (2S)-2-{[ethyl(2-hydroxyethyl)amino]methyl}pyrrolidine-1-carboxylate |
SMILES | CCN(CCO)C[C@@H]1CCCN1C(=O)OCC1=CC=CC=C1 |
INCHI Code | InChI=1S/C17H26N2O3/c1-2-18(11-12-20)13-16-9-6-10-19(16)17(21)22-14-15-7-4-3-5-8-15/h3-5,7-8,16,20H,2,6,9-14H2,1H3/t16-/m0/s1 |
Asymmetric atoms | 1 |
LogP | 1.911743 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.5882353 |
Concept Codes | Phenyl, Aliphatic alcohol, Heterocycle, Tertiary amine, Amine (P+S+T), Chiral, NCbz, 5-Membered heterocycle, Pyrrolidine, Cyclic, Aromatic, O-Benzyl |