2-(1-Benzyl-piperidin-2-ylmethoxy)-ethanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F080492 |
---|---|
Product Name | 2-(1-Benzyl-piperidin-2-ylmethoxy)-ethanol |
Other Names | 2-((1-Benzylpiperidin-2-yl)methoxy)ethanol |
CAS | 1353951-91-3 |
Molecular weight | 249.354 |
IUPAC Name | 2-[(1-benzylpiperidin-2-yl)methoxy]ethan-1-ol |
SMILES | OCCOCC1CCCCN1CC1=CC=CC=C1 |
INCHI Code | InChI=1/C15H23NO2/c17-10-11-18-13-15-8-4-5-9-16(15)12-14-6-2-1-3-7-14/h1-3,6-7,15,17H,4-5,8-13H2 |
Asymmetric atoms | 1 |
LogP | 2.0876982 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.6 |
Concept Codes | Phenyl, Aliphatic alcohol, Ether, Heterocycle, Tertiary amine, Amine (P+S+T), NBenzyl, 6-Membered heterocycle, Piperidine, Cyclic, Aromatic, PEG-2 |