3-Methyl-5-nitroaniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F077995 |
---|---|
Product Name | 3-Methyl-5-nitroaniline |
CAS | 618-61-1 |
Purity | 95.0% |
Molecular weight | 152.153 |
IUPAC Name | 3-methyl-5-nitroaniline |
SMILES | CC1=CC(N)=CC(=C1)[N+]([O-])=O |
INCHI Code | InChI=1S/C7H8N2O2/c1-5-2-6(8)4-7(3-5)9(10)11/h2-4H,8H2,1H3 |
Asymmetric atoms | 0 |
LogP | 1.5977254 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Primary amine, Amine (P+S+T), Nitro, Methyl, Tolyl, Aniline, Nitrobenzene, Cyclic, Aromatic |