Imidazo[1,2-a]pyridin-5-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F077365 |
---|---|
Product Name | Imidazo[1,2-a]pyridin-5-amine |
Other Names | Imidazo[1,2-a]pyridin-5-ylamine |
CAS | 66358-23-4 |
Purity | 95.0% |
Molecular weight | 133.154 |
IUPAC Name | imidazo[1,2-a]pyridin-5-amine |
SMILES | NC1=CC=CC2=NC=CN12 |
INCHI Code | InChI=1S/C7H7N3/c8-6-2-1-3-7-9-4-5-10(6)7/h1-5H,8H2 |
Asymmetric atoms | 0 |
LogP | 0.01991448 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclic, Aromatic |