2,6-Difluoro-4-nitrophenol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F076162 |
---|---|
Product Name | 2,6-Difluoro-4-nitrophenol |
CAS | 658-07-1 |
Purity | 97.0% |
Molecular weight | 175.091 |
IUPAC Name | 2,6-difluoro-4-nitrophenol |
SMILES | OC1=C(F)C=C(C=C1F)[N+]([O-])=O |
INCHI Code | InChI=1S/C6H3F2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H |
Asymmetric atoms | 0 |
LogP | 1.8950685 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Nitro, Fluoro, Halo, Aromatic alcohol, 1,3-Difluorobenzene, Difluorobenzene, Nitrobenzene, Phenol, Cyclic, Aromatic |