N-(2,6-Difluorobenzyl)piperidin-4-amine dihydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F069504 |
---|---|
Product Name | N-(2,6-Difluorobenzyl)piperidin-4-amine dihydrochloride |
Other Names | N-(2,6-Difluorobenzyl)piperidin-4-aminedihydrochloride |
CAS | 1349716-13-7 |
Molecular weight | 299.19 |
IUPAC Name | N-[(2,6-difluorophenyl)methyl]piperidin-4-amine dihydrochloride |
SMILES | Cl.Cl.FC1=CC=CC(F)=C1CNC1CCNCC1 |
INCHI Code | InChI=1S/C12H16F2N2.2ClH/c13-11-2-1-3-12(14)10(11)8-16-9-4-6-15-7-5-9;;/h1-3,9,15-16H,4-8H2;2*1H |
Asymmetric atoms | 0 |
LogP | 1.4607567 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.5 |
Concept Codes | Phenyl, Heterocycle, Secondary amine, Amine (P+S+T), Fluoro, Halo, Hydrochloride, Diamine, 1,3-Difluorobenzene, 6-Membered heterocycle, Difluorobenzene, Piperidine, Cyclic, Aromatic |