2-Chloro-1,3-dinitrobenzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F067190 |
---|---|
Product Name | 2-Chloro-1,3-dinitrobenzene |
CAS | 606-21-3 |
Purity | 97.0% |
Molecular weight | 202.55 |
IUPAC Name | 2-chloro-1,3-dinitrobenzene |
SMILES | [O-][N+](=O)C1=CC=CC(=C1Cl)[N+]([O-])=O |
INCHI Code | InChI=1S/C6H3ClN2O4/c7-6-4(8(10)11)2-1-3-5(6)9(12)13/h1-3H |
Asymmetric atoms | 0 |
LogP | 2.457259 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Nitro, Chloro, Halo, Disubstituted (2,6)- monochlorobenzene, Monochlorobenzene, Nitrobenzene, Cyclic, Aromatic, 1-Chloro-2-nitrobenzene, 1-Halo-2-nitrobenzene |