4-Methylpyridine-2,3-diamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F064832 |
---|---|
Product Name | 4-Methylpyridine-2,3-diamine |
Other Names | 4-Methyl-2,3-diaminopyridine 4-methyl-2,3-pyridinediamine |
CAS | 53929-59-2 |
Purity | 97.0% |
Molecular weight | 123.159 |
IUPAC Name | 4-methylpyridine-2,3-diamine |
SMILES | CC1=C(N)C(N)=NC=C1 |
INCHI Code | InChI=1S/C6H9N3/c1-4-2-3-9-6(8)5(4)7/h2-3H,7H2,1H3,(H2,8,9) |
Asymmetric atoms | 0 |
LogP | 0.2056004 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.16666667 |
Concept Codes | Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Methyl, Diamine, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |