1-(Pentan-3-yl)piperidin-4-amine dihydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F063786 |
---|---|
Product Name | 1-(Pentan-3-yl)piperidin-4-amine dihydrochloride |
CAS | 1286274-33-6 |
Purity | 95.0% |
Molecular weight | 243.22 |
IUPAC Name | 1-(pentan-3-yl)piperidin-4-amine dihydrochloride |
SMILES | Cl.Cl.CCC(CC)N1CCC(N)CC1 |
INCHI Code | InChI=1S/C10H22N2.2ClH/c1-3-10(4-2)12-7-5-9(11)6-8-12;;/h9-10H,3-8,11H2,1-2H3;2*1H |
Asymmetric atoms | 0 |
LogP | 1.2197751 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Heterocycle, Primary amine, Tertiary amine, Amine (P+S+T), Hydrochloride, Diamine, 6-Membered heterocycle, Piperidine, Cyclic |