1-Piperidin-1-ylmethyl-cyclohexylamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F059178 |
---|---|
Product Name | 1-Piperidin-1-ylmethyl-cyclohexylamine |
Other Names | 1-(Piperidin-1-ylmethyl)cyclohexan-1-amine 1-(piperidin-1-ylmethyl)cyclohexanamine |
CAS | 220137-70-2 |
Purity | 95.0% |
Molecular weight | 196.338 |
IUPAC Name | 1-[(piperidin-1-yl)methyl]cyclohexan-1-amine |
SMILES | NC1(CN2CCCCC2)CCCCC1 |
INCHI Code | InChI=1S/C12H24N2/c13-12(7-3-1-4-8-12)11-14-9-5-2-6-10-14/h1-11,13H2 |
Asymmetric atoms | 0 |
LogP | 1.966591 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Heterocycle, Primary amine, Tertiary amine, Amine (P+S+T), Diamine, 6-Membered heterocycle, Piperidine, Cyclohexane, Cyclic |