2-(1-Aminocyclobutyl)ethanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F054548 |
---|---|
Product Name | 2-(1-Aminocyclobutyl)ethanol |
Other Names | 2-(1-Aminocyclobutyl)ethan-1-ol |
CAS | 1132814-49-3 |
Purity | 95.0% |
Molecular weight | 115.176 |
IUPAC Name | 2-(1-aminocyclobutyl)ethan-1-ol |
SMILES | NC1(CCO)CCC1 |
INCHI Code | InChI=1S/C6H13NO/c7-6(4-5-8)2-1-3-6/h8H,1-5,7H2 |
Asymmetric atoms | 0 |
LogP | -0.42169923 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 1 |
Concept Codes | Aliphatic alcohol, Primary amine, Amine (P+S+T), Cyclobutane, Cyclic |