Methyl 4-(bromomethyl)cyclohexanecarboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F054107 |
---|---|
Product Name | Methyl 4-(bromomethyl)cyclohexanecarboxylate |
CAS | 1331776-42-1 |
Purity | 97.0% |
Molecular weight | 235.121 |
IUPAC Name | methyl 4-(bromomethyl)cyclohexane-1-carboxylate |
SMILES | COC(=O)C1CCC(CBr)CC1 |
INCHI Code | InChI=1S/C9H15BrO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h7-8H,2-6H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.504432 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.8888889 |
Concept Codes | Ester, Bromo, Halo, Cyclohexane, Cyclic |