2-Cyano-5-bromothiophene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F049323 |
---|---|
Product Name | 2-Cyano-5-bromothiophene |
Other Names | 5-Bromo-2-thiophenecarbonitrile 5-Bromothiophene-2-carbonitrile |
CAS | 2160-62-5 |
Purity | 95.0% |
Molecular weight | 188.04 |
IUPAC Name | 5-bromothiophene-2-carbonitrile |
SMILES | BrC1=CC=C(S1)C#N |
INCHI Code | InChI=1S/C5H2BrNS/c6-5-2-1-4(3-7)8-5/h1-2H |
Asymmetric atoms | 0 |
LogP | 2.676972 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Heterocycle, Heteroaromatic, Nitrile, Sulfide, Bromo, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |