Hexabromobenzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F046825 |
---|---|
Product Name | Hexabromobenzene |
CAS | 87-82-1 |
Purity | 98.00% |
Molecular weight | 551.49 |
IUPAC Name | hexabromobenzene |
SMILES | BrC1=C(Br)C(Br)=C(Br)C(Br)=C1Br |
INCHI Code | InChI=1S/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
Asymmetric atoms | 0 |
LogP | 6.5857615 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Bromo, Halo, Hexabromobenzene, Cyclic, Aromatic |