(3-Bromo-4-chloro-phenyl)-acetonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F044660 |
---|---|
Product Name | (3-Bromo-4-chloro-phenyl)-acetonitrile |
Other Names | 2-(3-Bromo-4-chlorophenyl)acetonitrile |
CAS | 249647-28-7 |
Purity | 97.0% |
Molecular weight | 230.49 |
IUPAC Name | 2-(3-bromo-4-chlorophenyl)acetonitrile |
SMILES | ClC1=C(Br)C=C(CC#N)C=C1 |
INCHI Code | InChI=1S/C8H5BrClN/c9-7-5-6(3-4-11)1-2-8(7)10/h1-2,5H,3H2 |
Asymmetric atoms | 0 |
LogP | 3.0417402 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Nitrile, Chloro, Bromo, Halo, Disubstituted (2,4)- monochlorobenzene, Disubstituted (2,5)- monobromobenzene, Monobromobenzene, Monochlorobenzene, Cyclic, Aromatic |