5-(Trifluoromethyl)pyridin-3-ylboronic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F043582 |
---|---|
Product Name | 5-(Trifluoromethyl)pyridin-3-ylboronic acid |
CAS | 947533-51-9 |
Purity | 95.0% |
Molecular weight | 190.92 |
IUPAC Name | [5-(trifluoromethyl)pyridin-3-yl]boronic acid |
SMILES | OB(O)C1=CN=CC(=C1)C(F)(F)F |
INCHI Code | InChI=1S/C6H5BF3NO2/c8-6(9,10)4-1-5(7(12)13)3-11-2-4/h1-3,12-13H |
Asymmetric atoms | 0 |
LogP | 1.2107 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.16666667 |
Concept Codes | Heterocycle, Heteroaromatic, Fluoro, Halo, Trifluoromethyl, Boronic acid, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic, PFA01, PFA02 |