(Isobutyrylamino)acetic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F038964 |
---|---|
Product Name | (Isobutyrylamino)acetic acid |
Other Names | N-Isobutyrylglycine |
CAS | 15926-18-8 |
Purity | 95.0% |
Molecular weight | 145.158 |
IUPAC Name | 2-(2-methylpropanamido)acetic acid |
SMILES | CC(C)C(=O)NCC(O)=O |
INCHI Code | InChI=1S/C6H11NO3/c1-4(2)6(10)7-3-5(8)9/h4H,3H2,1-2H3,(H,7,10)(H,8,9) |
Asymmetric atoms | 0 |
LogP | -0.08510683 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.6666667 |
Concept Codes | Carboxylic acid, Amide, Alpha-amino acid |