4-Nitrophenyltriflate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F038407 |
---|---|
Product Name | 4-Nitrophenyltriflate |
CAS | 17763-80-3 |
Purity | 99.0% |
Molecular weight | 271.17 |
IUPAC Name | 4-nitrophenyl trifluoromethanesulfonate |
SMILES | [O-][N+](=O)C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1 |
INCHI Code | InChI=1S/C7H4F3NO5S/c8-7(9,10)17(14,15)16-6-3-1-5(2-4-6)11(12)13/h1-4H |
Asymmetric atoms | 0 |
LogP | 3.1239405 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Nitro, Fluoro, Halo, Trifluoromethyl, Sulfonate, Triflate, Nitrobenzene, Cyclic, Aromatic, PFA01, PFA02 |