2-Chloro-5-trifluoromethylbenzenethiol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F037888 |
---|---|
Product Name | 2-Chloro-5-trifluoromethylbenzenethiol |
Other Names | 2-Chloro-5-trifluoromethyl-benzenethiol |
CAS | 18906-40-6 |
Molecular weight | 212.61 |
IUPAC Name | 2-chloro-5-(trifluoromethyl)benzene-1-thiol |
SMILES | FC(F)(F)C1=CC(S)=C(Cl)C=C1 |
INCHI Code | InChI=1S/C7H4ClF3S/c8-5-2-1-4(3-6(5)12)7(9,10)11/h1-3,12H |
Asymmetric atoms | 0 |
LogP | 3.548346 |
H bond acceptors | 0 |
H bond donors | 1 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Fluoro, Chloro, Halo, Aromatic thiol, Trifluoromethyl, Disubstituted (2,4)- monochlorobenzene, Monochlorobenzene, Cyclic, Aromatic, PFA01, PFA02 |