6-Acetyl-picolinic acid ethyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F036641 |
---|---|
Product Name | 6-Acetyl-picolinic acid ethyl ester |
CAS | 114578-70-0 |
Purity | 97.0% |
Molecular weight | 193.202 |
IUPAC Name | ethyl 6-acetylpyridine-2-carboxylate |
SMILES | CCOC(=O)C1=CC=CC(=N1)C(C)=O |
INCHI Code | InChI=1S/C10H11NO3/c1-3-14-10(13)9-6-4-5-8(11-9)7(2)12/h4-6H,3H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 1.2452065 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.3 |
Concept Codes | Ketone, Ester, Heterocycle, Heteroaromatic, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |