1-(4'-Chlorobiphenyl-4-yl)ethanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F036013 |
---|---|
Product Name | 1-(4'-Chlorobiphenyl-4-yl)ethanone |
Other Names | 1-(4'-Chloro-[1,1'-biphenyl]-4-yl)ethan-1-one 4-ACETYL-4'-CHLOROBIPHENYL 1-(4'-CHLORO-BIPHENYL-4-YL)-ETHANONE |
CAS | 5002-07-3 |
Molecular weight | 230.69 |
IUPAC Name | 1-{4'-chloro-[1,1'-biphenyl]-4-yl}ethan-1-one |
SMILES | CC(=O)C1=CC=C(C=C1)C1=CC=C(Cl)C=C1 |
INCHI Code | InChI=1S/C14H11ClO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h2-9H,1H3 |
Asymmetric atoms | 0 |
LogP | 3.7821634 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.071428575 |
Concept Codes | Phenyl, Ketone, Chloro, Halo, Monochlorobenzene, Monosubstituted (para) monochlorobenzene, Cyclic, Aromatic, Acetophenone, Biphenyl |