C -(3,5-Dimethyl-1-phenyl-1 H -pyrazol-4-yl)-methylamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F030521 |
---|---|
Product Name | C -(3,5-Dimethyl-1-phenyl-1 H -pyrazol-4-yl)-methylamine |
Other Names | C-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)-methylamine |
CAS | 879896-52-3 |
Molecular weight | 201.273 |
IUPAC Name | 1-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)methanamine |
SMILES | CC1=NN(C(C)=C1CN)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C12H15N3/c1-9-12(8-13)10(2)15(14-9)11-6-4-3-5-7-11/h3-7H,8,13H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 1.5157642 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Methyl, Dimethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Pyrazole, Cyclic, Aromatic |