3-(Methylsulfonyl)phenylacetic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F023583 |
---|---|
Product Name | 3-(Methylsulfonyl)phenylacetic acid |
CAS | 1877-64-1 |
Purity | 95.0% |
Molecular weight | 214.24 |
IUPAC Name | 2-(3-methanesulfonylphenyl)acetic acid |
SMILES | CS(=O)(=O)C1=CC=CC(CC(O)=O)=C1 |
INCHI Code | InChI=1S/C9H10O4S/c1-14(12,13)8-4-2-3-7(5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
Asymmetric atoms | 0 |
LogP | 0.45130265 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.22222222 |
Concept Codes | Phenyl, Carboxylic acid, Sulfone, Cyclic, Aromatic |