3-Chloro-3',5'-difluorobenzophenone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F022822 |
---|---|
Product Name | 3-Chloro-3',5'-difluorobenzophenone |
Other Names | (3-Chlorophenyl)(3,5-difluorophenyl)methanone |
CAS | 746651-98-9 |
Purity | 97.0% |
Molecular weight | 252.64 |
IUPAC Name | (3-chlorophenyl)(3,5-difluorophenyl)methanone |
SMILES | FC1=CC(=CC(F)=C1)C(=O)C1=CC(Cl)=CC=C1 |
INCHI Code | InChI=1S/C13H7ClF2O/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7H |
Asymmetric atoms | 0 |
LogP | 4.322047 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Ketone, Fluoro, Chloro, Halo, 1,3-Difluorobenzene, Difluorobenzene, Monochlorobenzene, Monosubstituted (meta) monochlorobenzene, Cyclic, Aromatic, Benzophenone |