3-Chloro-4'-(ethylthio)benzhydrol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F022483 |
---|---|
Product Name | 3-Chloro-4'-(ethylthio)benzhydrol |
Other Names | (3-Chlorophenyl)(4-(ethylthio)phenyl)methanol |
CAS | 844683-56-3 |
Purity | 97.0% |
Molecular weight | 278.79 |
IUPAC Name | (3-chlorophenyl)[4-(ethylsulfanyl)phenyl]methanol |
SMILES | CCSC1=CC=C(C=C1)C(O)C1=CC(Cl)=CC=C1 |
INCHI Code | InChI=1/C15H15ClOS/c1-2-18-14-8-6-11(7-9-14)15(17)12-4-3-5-13(16)10-12/h3-10,15,17H,2H2,1H3 |
Asymmetric atoms | 1 |
LogP | 4.475428 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.2 |
Concept Codes | Phenyl, Aliphatic alcohol, Sulfide, Chloro, Halo, Monochlorobenzene, Monosubstituted (meta) monochlorobenzene, Cyclic, Aromatic, Benzhydryl, Benzhydrol |