4-(2-Methoxyphenyl)-3-thiosemicarbazide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F018806 |
---|---|
Product Name | 4-(2-Methoxyphenyl)-3-thiosemicarbazide |
Other Names | N-(2-Methoxyphenyl)hydrazinecarbothioamide |
CAS | 40207-02-1 |
Purity | 95.0% |
Molecular weight | 197.26 |
IUPAC Name | 3-amino-1-(2-methoxyphenyl)thiourea |
SMILES | COC1=C(NC(=S)NN)C=CC=C1 |
INCHI Code | InChI=1S/C8H11N3OS/c1-12-7-5-3-2-4-6(7)10-8(13)11-9/h2-5H,9H2,1H3,(H2,10,11,13) |
Asymmetric atoms | 0 |
LogP | 1.3131332 |
H bond acceptors | 2 |
H bond donors | 3 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Methoxy, Ether, Thiosemicarbazide, Thiosemicarbazide, Cyclic, Aromatic, Anisole |