4-Bromo-1-(tert-butyldimethylsilyl)indole
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F016199 |
---|---|
Product Name | 4-Bromo-1-(tert-butyldimethylsilyl)indole |
Other Names | 4-BROMO-1-(TERT-BUTYLDIMETHYLSILYL)-1H-INDOLE 4-Bromo-1-[(tert-butyl)dimethylsilyl]-1H-indole |
CAS | 193694-04-1 |
Purity | 95.0% |
Molecular weight | 310.31 |
IUPAC Name | 4-bromo-1-(tert-butyldimethylsilyl)-1H-indole |
SMILES | CC(C)(C)[Si](C)(C)N1C=CC2=C(Br)C=CC=C12 |
INCHI Code | InChI=1S/C14H20BrNSi/c1-14(2,3)17(4,5)16-10-9-11-12(15)7-6-8-13(11)16/h6-10H,1-5H3 |
Asymmetric atoms | 0 |
LogP | 4.8419 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.42857143 |
Concept Codes | Heterocycle, Heteroaromatic, Bromo, Halo, Organosilicon, 5-Membered heteroaromatic, 5-Membered heterocycle, Indole, Cyclic, Aromatic |