3-Amino-5-chloro-benzofuran-2-carboxylic acid methyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F015396 |
---|---|
Product Name | 3-Amino-5-chloro-benzofuran-2-carboxylic acid methyl ester |
CAS | 406929-36-0 |
Purity | 98% |
Molecular weight | 225.63 |
IUPAC Name | methyl 3-amino-5-chloro-1-benzofuran-2-carboxylate |
SMILES | COC(=O)C1=C(N)C2=CC(Cl)=CC=C2O1 |
INCHI Code | InChI=1S/C10H8ClNO3/c1-14-10(13)9-8(12)6-4-5(11)2-3-7(6)15-9/h2-4H,12H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.480966 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.1 |
Concept Codes | Ester, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Chloro, Halo, Amino acid ester, 5-Membered heteroaromatic, 5-Membered heterocycle, Benzofuran, Cyclic, Aromatic |