2-Ethoxy-4-formylphenyl cyclohexanecarboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F014198 |
---|---|
Product Name | 2-Ethoxy-4-formylphenyl cyclohexanecarboxylate |
CAS | 312525-47-6 |
Molecular weight | 276.332 |
IUPAC Name | 2-ethoxy-4-formylphenyl cyclohexanecarboxylate |
SMILES | CCOC1=C(OC(=O)C2CCCCC2)C=CC(C=O)=C1 |
INCHI Code | InChI=1S/C16H20O4/c1-2-19-15-10-12(11-17)8-9-14(15)20-16(18)13-6-4-3-5-7-13/h8-11,13H,2-7H2,1H3 |
Asymmetric atoms | 0 |
LogP | 3.605648 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.5 |
Concept Codes | Phenyl, Aldehyde, Ester, Ether, Cyclohexane, Cyclic, Aromatic, Benzaldehyde |