3-n-Pentoxybenzaldehyde
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F014183 |
---|---|
Product Name | 3-n-Pentoxybenzaldehyde |
Other Names | 3-(Pentyloxy)benzaldehyde 3-Pentyloxybenzaldehyde |
CAS | 24083-06-5 |
Purity | 97.0% |
Molecular weight | 192.258 |
IUPAC Name | 3-(pentyloxy)benzaldehyde |
SMILES | CCCCCOC1=CC(C=O)=CC=C1 |
INCHI Code | InChI=1S/C12H16O2/c1-2-3-4-8-14-12-7-5-6-11(9-12)10-13/h5-7,9-10H,2-4,8H2,1H3 |
Asymmetric atoms | 0 |
LogP | 3.2965446 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.41666666 |
Concept Codes | Phenyl, Aldehyde, Ether, Cyclic, Aromatic, Benzaldehyde |