2-Amino-4-biphenyl-4-yl-thiophene-3-carboxylic acid methyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F014065 |
---|---|
Product Name | 2-Amino-4-biphenyl-4-yl-thiophene-3-carboxylic acid methyl ester |
CAS | 350997-16-9 |
Purity | 97% |
Molecular weight | 309.38 |
IUPAC Name | methyl 2-amino-4-{[1,1'-biphenyl]-4-yl}thiophene-3-carboxylate |
SMILES | COC(=O)C1=C(N)SC=C1C1=CC=C(C=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C18H15NO2S/c1-21-18(20)16-15(11-22-17(16)19)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-11H,19H2,1H3 |
Asymmetric atoms | 0 |
LogP | 5.0386853 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.055555556 |
Concept Codes | Phenyl, Ester, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfide, Amino acid ester, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic, Biphenyl |