1-(3-Pentyl)-piperazine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F009821 |
---|---|
Product Name | 1-(3-Pentyl)-piperazine |
Other Names | 1-(3-PENTYL)PIPERAZINE 1-(Pent-3-yl)piperazine 1-(1-Ethylpropyl)piperazine |
CAS | 373356-51-5 |
Purity | 98.0% |
Molecular weight | 156.273 |
IUPAC Name | 1-(pentan-3-yl)piperazine |
SMILES | CCC(CC)N1CCNCC1 |
INCHI Code | InChI=1S/C9H20N2/c1-3-9(4-2)11-7-5-10-6-8-11/h9-10H,3-8H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 1.4726689 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Heterocycle, Secondary amine, Tertiary amine, Amine (P+S+T), Diamine, 6-Membered heterocycle, Piperazine, Cyclic |