1H,1H-Perfluoro-n-decyl methacrylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F009315 |
---|---|
Product Name | 1H,1H-Perfluoro-n-decyl methacrylate |
CAS | 23069-32-1 |
Purity | 97.0% |
Molecular weight | 568.178 |
IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl 2-methylprop-2-enoate |
SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
INCHI Code | InChI=1S/C14H7F19O2/c1-4(2)5(34)35-3-6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)33/h1,3H2,2H3 |
Asymmetric atoms | 0 |
LogP | 7.8679633 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.78571427 |
Concept Codes | Ester, Fluoro, Halo, Trifluoromethyl, Alkene, PFA01, PFA02 |