5-Indanyl isothiocyanate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F008981 |
---|---|
Product Name | 5-Indanyl isothiocyanate |
Other Names | 5-Isothiocyanato-2,3-dihydro-1h-indene |
CAS | 149865-84-9 |
Purity | 99.0% |
Molecular weight | 175.25 |
IUPAC Name | 5-isothiocyanato-2,3-dihydro-1H-indene |
SMILES | S=C=NC1=CC2=C(CCC2)C=C1 |
INCHI Code | InChI=1S/C10H9NS/c12-7-11-10-5-4-8-2-1-3-9(8)6-10/h4-6H,1-3H2 |
Asymmetric atoms | 0 |
LogP | 4.0027566 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.3 |
Concept Codes | Isothiocyanate, Indane, Cyclic, Aromatic |