4-Methoxy-3-(trifluoromethyl)benzyl bromide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F005832 |
---|---|
Product Name | 4-Methoxy-3-(trifluoromethyl)benzyl bromide |
Other Names | 4-(Bromomethyl)-1-methoxy-2-(trifluoromethyl)benzene |
CAS | 261951-89-7 |
Purity | 95.0% |
Molecular weight | 269.061 |
IUPAC Name | 4-(bromomethyl)-1-methoxy-2-(trifluoromethyl)benzene |
SMILES | COC1=C(C=C(CBr)C=C1)C(F)(F)F |
INCHI Code | InChI=1S/C9H8BrF3O/c1-14-8-3-2-6(5-10)4-7(8)9(11,12)13/h2-4H,5H2,1H3 |
Asymmetric atoms | 0 |
LogP | 3.4661603 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.33333334 |
Concept Codes | Phenyl, Methoxy, Ether, Fluoro, Bromo, Halo, Trifluoromethyl, Cyclic, Aromatic, Anisole, Benzyl bromide, PFA01, PFA02 |